CAS 1461706-20-6 appears in our catalog under these names: 2-Amino-2-methyl-3-(1h-1,2,4-triazol-1-yl)propanoic acid dihydrochloride, 95%, 2-Amino-2-methyl-3-(1H-1,2,4-triazol-1-yl)propanoic acid dihydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 0,5g, 50mg.
2-amino-2-methyl-3-(1,2,4-triazol-1-yl)propanoic acid;dihydrochloride (CAS 1461706-20-6) is a chemical compound with the molecular formula C6H12Cl2N4O2 and a molecular weight of 243.09 g/mol. IUPAC name: 2-amino-2-methyl-3-(1,2,4-triazol-1-yl)propanoic acid;dihydrochloride. InChIKey: BZOSAZGJOBKHMQ-UHFFFAOYSA-N.
| Molecular formula | C6H12Cl2N4O2 |
|---|---|
| Molecular weight | 243.09 g/mol |
| IUPAC name | 2-amino-2-methyl-3-(1,2,4-triazol-1-yl)propanoic acid;dihydrochloride |
| InChIKey | BZOSAZGJOBKHMQ-UHFFFAOYSA-N |
| SMILES | CC(CN1C=NC=N1)(C(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)