CAS 1461706-29-5 appears in our catalog under these names: Thiomorpholine-3-carboxylic acid 1,1-dioxide hydrochloride, 95%, 3-​Thiomorpholinecarbox​ylic acid 1,​1-​dioxide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 1g, 0,5g, 50mg.
1,1-dioxo-1,4-thiazinane-3-carboxylic acid;hydrochloride (CAS 1461706-29-5) is a chemical compound with the molecular formula C5H10ClNO4S and a molecular weight of 215.66 g/mol. IUPAC name: 1,1-dioxo-1,4-thiazinane-3-carboxylic acid;hydrochloride. InChIKey: NJFKFCKXKGINON-UHFFFAOYSA-N.
| Molecular formula | C5H10ClNO4S |
|---|---|
| Molecular weight | 215.66 g/mol |
| IUPAC name | 1,1-dioxo-1,4-thiazinane-3-carboxylic acid;hydrochloride |
| InChIKey | NJFKFCKXKGINON-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC(N1)C(=O)O.Cl |
Computed by PubChem (NCBI)