CAS 1461707-07-2 is the registry number for 4-(Pentafluorosulfanyl)benzenesulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(pentafluoro-lambda6-sulfanyl)benzenesulfonamide (CAS 1461707-07-2) is a chemical compound with the molecular formula C6H6F5NO2S2 and a molecular weight of 283.2 g/mol. IUPAC name: 4-(pentafluoro-lambda6-sulfanyl)benzenesulfonamide. InChIKey: LHTIHFUKCUWZLK-UHFFFAOYSA-N.
| Molecular formula | C6H6F5NO2S2 |
|---|---|
| Molecular weight | 283.2 g/mol |
| IUPAC name | 4-(pentafluoro-lambda6-sulfanyl)benzenesulfonamide |
| InChIKey | LHTIHFUKCUWZLK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)N)S(F)(F)(F)(F)F |
Computed by PubChem (NCBI)