CAS 1461707-52-7 appears in our catalog under these names: Sodium 5-hydroxydec-9-enoate, 95%, Sodium 5-hydroxydec-9-enoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Sodium 5-hydroxydec-9-enoate (CAS 1461707-52-7) is a chemical compound with the molecular formula C10H17NaO3 and a molecular weight of 208.23 g/mol. IUPAC name: sodium 5-hydroxydec-9-enoate. InChIKey: FESRIADADYQPHF-UHFFFAOYSA-M.
| Molecular formula | C10H17NaO3 |
|---|---|
| Molecular weight | 208.23 g/mol |
| IUPAC name | sodium 5-hydroxydec-9-enoate |
| InChIKey | FESRIADADYQPHF-UHFFFAOYSA-M |
| SMILES | C=CCCCC(CCCC(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)