Products 1461707-59-4
CAS 1461707-59-4 appears in our catalog under these names: 1-(4-Fluorobenzoyl)pyrrolidin-3-amine hydrochloride, 1-(4-Fluorobenzoyl)pyrrolidin-3-amine hydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 5g.
(3-aminopyrrolidin-1-yl)-(4-fluorophenyl)methanone;hydrochloride (CAS 1461707-59-4) is a chemical compound with the molecular formula C11H14ClFN2O and a molecular weight of 244.69 g/mol. IUPAC name: (3-aminopyrrolidin-1-yl)-(4-fluorophenyl)methanone;hydrochloride. InChIKey: AAFSHCFLUQNOOR-UHFFFAOYSA-N.
| Molecular formula | C11H14ClFN2O |
|---|---|
| Molecular weight | 244.69 g/mol |
| IUPAC name | (3-aminopyrrolidin-1-yl)-(4-fluorophenyl)methanone;hydrochloride |
| InChIKey | AAFSHCFLUQNOOR-UHFFFAOYSA-N |
| SMILES | C1CN(CC1N)C(=O)C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)