Products 1461707-60-7

CAS 1461707-60-7 appears in our catalog under these names: 2-(2,2-Difluoroethoxy)ethane-1-sulfonyl chloride, 95%, 2-(2,2-Difluoroethoxy)ethane-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

2-(2,2-difluoroethoxy)ethanesulfonyl chloride (CAS 1461707-60-7) is a chemical compound with the molecular formula C4H7ClF2O3S and a molecular weight of 208.61 g/mol. IUPAC name: 2-(2,2-difluoroethoxy)ethanesulfonyl chloride. InChIKey: YCYMBNVPYDFDIG-UHFFFAOYSA-N.

Identity
Molecular formulaC4H7ClF2O3S
Molecular weight208.61 g/mol
IUPAC name2-(2,2-difluoroethoxy)ethanesulfonyl chloride
InChIKeyYCYMBNVPYDFDIG-UHFFFAOYSA-N
SMILESC(CS(=O)(=O)Cl)OCC(F)F

Computed by PubChem (NCBI)