CAS 1461708-54-2 appears in our catalog under these names: (4-Chloro-2,6-difluorophenyl)hydrazine hydrochloride, 95%, (4-Chloro-2,6-difluorophenyl)hydrazine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(4-chloro-2,6-difluorophenyl)hydrazine;hydrochloride (CAS 1461708-54-2) is a chemical compound with the molecular formula C6H6Cl2F2N2 and a molecular weight of 215.02 g/mol. IUPAC name: (4-chloro-2,6-difluorophenyl)hydrazine;hydrochloride. InChIKey: JIBUAOXKYCKFEL-UHFFFAOYSA-N.
| Molecular formula | C6H6Cl2F2N2 |
|---|---|
| Molecular weight | 215.02 g/mol |
| IUPAC name | (4-chloro-2,6-difluorophenyl)hydrazine;hydrochloride |
| InChIKey | JIBUAOXKYCKFEL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)NN)F)Cl.Cl |
Computed by PubChem (NCBI)