CAS 1461709-32-9 appears in our catalog under these names: Lithium(1+) ion 5-ethyl-1,3-thiazole-2-carboxylate, 95%, 5-Ethyl-1,3-thiazole-2-carboxylate lithium(I). Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Lithium 5-ethyl-1,3-thiazole-2-carboxylate (CAS 1461709-32-9) is a chemical compound with the molecular formula C6H6LiNO2S and a molecular weight of 163.2 g/mol. IUPAC name: lithium 5-ethyl-1,3-thiazole-2-carboxylate. InChIKey: YQYYNXRFIYIBML-UHFFFAOYSA-M.
| Molecular formula | C6H6LiNO2S |
|---|---|
| Molecular weight | 163.2 g/mol |
| IUPAC name | lithium 5-ethyl-1,3-thiazole-2-carboxylate |
| InChIKey | YQYYNXRFIYIBML-UHFFFAOYSA-M |
| SMILES | [Li+].CCC1=CN=C(S1)C(=O)[O-] |
Computed by PubChem (NCBI)