CAS 1461713-37-0 appears in our catalog under these names: 4-Bromo-2,6-dimethyl-N-(1,2-oxazol-4-ylmethyl)aniline hydrobromide, 95%, 4-Bromo-2,6-dimethyl-N-(1,2-oxazol-4-ylmethyl)aniline hydrobromide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-bromo-2,6-dimethyl-N-(1,2-oxazol-4-ylmethyl)aniline;hydrobromide (CAS 1461713-37-0) is a chemical compound with the molecular formula C12H14Br2N2O and a molecular weight of 362.06 g/mol. IUPAC name: 4-bromo-2,6-dimethyl-N-(1,2-oxazol-4-ylmethyl)aniline;hydrobromide. InChIKey: MMGHWVXLKWQLGC-UHFFFAOYSA-N.
| Molecular formula | C12H14Br2N2O |
|---|---|
| Molecular weight | 362.06 g/mol |
| IUPAC name | 4-bromo-2,6-dimethyl-N-(1,2-oxazol-4-ylmethyl)aniline;hydrobromide |
| InChIKey | MMGHWVXLKWQLGC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1NCC2=CON=C2)C)Br.Br |
Computed by PubChem (NCBI)