CAS 1461714-94-2 appears in our catalog under these names: 7-Chloro-3-methyl-2,3,4,5-tetrahydro-1,5-benzothiazepine hydrochloride, 95%, 7-Chloro-3-methyl-2,3,4,5-tetrahydro-1,5-benzothiazepine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
7-chloro-3-methyl-2,3,4,5-tetrahydro-1,5-benzothiazepine;hydrochloride (CAS 1461714-94-2) is a chemical compound with the molecular formula C10H13Cl2NS and a molecular weight of 250.19 g/mol. IUPAC name: 7-chloro-3-methyl-2,3,4,5-tetrahydro-1,5-benzothiazepine;hydrochloride. InChIKey: ODNHJQBSXXNZIO-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2NS |
|---|---|
| Molecular weight | 250.19 g/mol |
| IUPAC name | 7-chloro-3-methyl-2,3,4,5-tetrahydro-1,5-benzothiazepine;hydrochloride |
| InChIKey | ODNHJQBSXXNZIO-UHFFFAOYSA-N |
| SMILES | CC1CNC2=C(C=CC(=C2)Cl)SC1.Cl |
Computed by PubChem (NCBI)