CAS 1461750-27-5 appears in our catalog under these names: Tianagliflozin, Tianagliflozin, 99.96%. Offered by: GLPBio, Chemat Brand, MedChemExpress. Available pack sizes: 5mg, on request, 10mg, 100mg, 25mg, 50mg, 100 mg, 10 mg.
(2S,3R,4S,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-methyloxane-3,4,5-triol (CAS 1461750-27-5) is a chemical compound with the molecular formula C21H25ClO5 and a molecular weight of 392.9 g/mol. IUPAC name: (2S,3R,4S,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-methyloxane-3,4,5-triol. InChIKey: YCEUTZKYUQXUCF-JLBFBPAZSA-N.
| Molecular formula | C21H25ClO5 |
|---|---|
| Molecular weight | 392.9 g/mol |
| IUPAC name | (2S,3R,4S,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-methyloxane-3,4,5-triol |
| InChIKey | YCEUTZKYUQXUCF-JLBFBPAZSA-N |
| SMILES | CCOC1=CC=C(C=C1)CC2=C(C=CC(=C2)[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)C)O)O)O)Cl |
Computed by PubChem (NCBI)