CAS 146204-42-4 appears in our catalog under these names: Bm212, 95%, BM212/ 98%, BM212, BM212, 98+%, 98+%, BM212, 99.56%. Offered by: Combi-blocks, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 200mg, 10mM (in 1ml dmso).
1-[[1,5-bis(4-chlorophenyl)-2-methylpyrrol-3-yl]methyl]-4-methylpiperazine (CAS 146204-42-4) is a chemical compound with the molecular formula C23H25Cl2N3 and a molecular weight of 414.4 g/mol. IUPAC name: 1-[[1,5-bis(4-chlorophenyl)-2-methylpyrrol-3-yl]methyl]-4-methylpiperazine. InChIKey: YWZIODCWLMCMMW-UHFFFAOYSA-N.
| Molecular formula | C23H25Cl2N3 |
|---|---|
| Molecular weight | 414.4 g/mol |
| IUPAC name | 1-[[1,5-bis(4-chlorophenyl)-2-methylpyrrol-3-yl]methyl]-4-methylpiperazine |
| InChIKey | YWZIODCWLMCMMW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(N1C2=CC=C(C=C2)Cl)C3=CC=C(C=C3)Cl)CN4CCN(CC4)C |
Computed by PubChem (NCBI)