Products 1462383-00-1
CAS 1462383-00-1 is the registry number for MK 319. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[2-[(4-bromo-2,3,5,6-tetrafluorophenyl)methylcarbamoyl]-5-chlorophenoxy]acetic acid (CAS 1462383-00-1) is a chemical compound with the molecular formula C16H9BrClF4NO4 and a molecular weight of 470.59 g/mol. IUPAC name: 2-[2-[(4-bromo-2,3,5,6-tetrafluorophenyl)methylcarbamoyl]-5-chlorophenoxy]acetic acid. InChIKey: KHMHPWZCDNMQKJ-UHFFFAOYSA-N.
| Molecular formula | C16H9BrClF4NO4 |
|---|---|
| Molecular weight | 470.59 g/mol |
| IUPAC name | 2-[2-[(4-bromo-2,3,5,6-tetrafluorophenyl)methylcarbamoyl]-5-chlorophenoxy]acetic acid |
| InChIKey | KHMHPWZCDNMQKJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)OCC(=O)O)C(=O)NCC2=C(C(=C(C(=C2F)F)Br)F)F |
Computed by PubChem (NCBI)