CAS 1462947-17-6 is the registry number for DS79540454. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-oxo-4-[[6-oxo-5-[(3-phenylphenyl)methylcarbamoyl]-1H-pyrimidin-2-yl]amino]butanoic acid (CAS 1462947-17-6) is a chemical compound with the molecular formula C22H20N4O5 and a molecular weight of 420.4 g/mol. IUPAC name: 4-oxo-4-[[6-oxo-5-[(3-phenylphenyl)methylcarbamoyl]-1H-pyrimidin-2-yl]amino]butanoic acid. InChIKey: VCOPQSOIAYXCGU-UHFFFAOYSA-N.
| Molecular formula | C22H20N4O5 |
|---|---|
| Molecular weight | 420.4 g/mol |
| IUPAC name | 4-oxo-4-[[6-oxo-5-[(3-phenylphenyl)methylcarbamoyl]-1H-pyrimidin-2-yl]amino]butanoic acid |
| InChIKey | VCOPQSOIAYXCGU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC(=C2)CNC(=O)C3=CN=C(NC3=O)NC(=O)CCC(=O)O |
Computed by PubChem (NCBI)