CAS 1463-72-5 appears in our catalog under these names: 3,7-Dimethyl-1h-indole-2-carbaldehyde, 95%, 3,7-Dimethyl-1H-indole-2-carbaldehyde, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
3,7-dimethyl-1H-indole-2-carbaldehyde (CAS 1463-72-5) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: 3,7-dimethyl-1H-indole-2-carbaldehyde. InChIKey: KFMJRJKKDWLVBF-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 3,7-dimethyl-1H-indole-2-carbaldehyde |
| InChIKey | KFMJRJKKDWLVBF-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=C(N2)C=O)C |
Computed by PubChem (NCBI)