CAS 146307-74-6 is the registry number for 4-(3,4-Dibromo-l-1,3-dioxolan-2-one) (+)-Anymol. Offered by: TRC. Available pack sizes: 250mg.
(4R)-4-[(1S,3R,4R)-3,4-dibromo-4-methylcyclohexyl]-4-methyl-1,3-dioxolan-2-one (CAS 146307-74-6) is a chemical compound with the molecular formula C11H16Br2O3 and a molecular weight of 356.05 g/mol. IUPAC name: (4R)-4-[(1S,3R,4R)-3,4-dibromo-4-methylcyclohexyl]-4-methyl-1,3-dioxolan-2-one. InChIKey: BVHSKKNAUKLEDJ-URPMGSGRSA-N.
| Molecular formula | C11H16Br2O3 |
|---|---|
| Molecular weight | 356.05 g/mol |
| IUPAC name | (4R)-4-[(1S,3R,4R)-3,4-dibromo-4-methylcyclohexyl]-4-methyl-1,3-dioxolan-2-one |
| InChIKey | BVHSKKNAUKLEDJ-URPMGSGRSA-N |
| SMILES | C[C@]1(CC[C@@H](C[C@H]1Br)[C@@]2(COC(=O)O2)C)Br |
Computed by PubChem (NCBI)