Products 14631-30-2

CAS 14631-30-2 is the registry number for Glycine, n-[5-(1,2-dithiolan-3-yl)-1-oxopentyl]-, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[5-(dithiolan-3-yl)pentanoylamino]acetic acid (CAS 14631-30-2) is a chemical compound with the molecular formula C10H17NO3S2 and a molecular weight of 263.4 g/mol. IUPAC name: 2-[5-(dithiolan-3-yl)pentanoylamino]acetic acid. InChIKey: OEMVHEWPHWIYFN-UHFFFAOYSA-N.

Identity
Molecular formulaC10H17NO3S2
Molecular weight263.4 g/mol
IUPAC name2-[5-(dithiolan-3-yl)pentanoylamino]acetic acid
InChIKeyOEMVHEWPHWIYFN-UHFFFAOYSA-N
SMILESC1CSSC1CCCCC(=O)NCC(=O)O

Computed by PubChem (NCBI)