CAS 146346-84-1 is the registry number for (2S)-2-{[(benzyloxy)carbonyl]amino}-3-[(tert-butyldimethylsilyl)oxy]propanoic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 25g, 100g, 250g.
(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 146346-84-1) is a chemical compound with the molecular formula C17H27NO5Si and a molecular weight of 353.5 g/mol. IUPAC name: (2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: WNDGUJLHARCBKY-AWEZNQCLSA-N.
| Molecular formula | C17H27NO5Si |
|---|---|
| Molecular weight | 353.5 g/mol |
| IUPAC name | (2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | WNDGUJLHARCBKY-AWEZNQCLSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)