CAS 146346-92-1 is the registry number for (4-Butoxybenzyl)triphenylphosphonium Bromide. Offered by: TRC. Available pack sizes: 5g.
(4-butoxyphenyl)methyl-triphenylphosphanium bromide (CAS 146346-92-1) is a chemical compound with the molecular formula C29H30BrOP and a molecular weight of 505.4 g/mol. IUPAC name: (4-butoxyphenyl)methyl-triphenylphosphanium bromide. InChIKey: DYBCXFJUMGEGBX-UHFFFAOYSA-M.
| Molecular formula | C29H30BrOP |
|---|---|
| Molecular weight | 505.4 g/mol |
| IUPAC name | (4-butoxyphenyl)methyl-triphenylphosphanium bromide |
| InChIKey | DYBCXFJUMGEGBX-UHFFFAOYSA-M |
| SMILES | CCCCOC1=CC=C(C=C1)C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Br-] |
Computed by PubChem (NCBI)