Products 1463475-67-3
CAS 1463475-67-3 is the registry number for Mtb-cyt-bd oxidase-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-methoxy-2-methyl-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-1H-quinolin-4-one (CAS 1463475-67-3) is a chemical compound with the molecular formula C26H35NO2 and a molecular weight of 393.6 g/mol. IUPAC name: 6-methoxy-2-methyl-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-1H-quinolin-4-one. InChIKey: HMSOLCQCVUZDCN-UFTLRZAHSA-N.
| Molecular formula | C26H35NO2 |
|---|---|
| Molecular weight | 393.6 g/mol |
| IUPAC name | 6-methoxy-2-methyl-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-1H-quinolin-4-one |
| InChIKey | HMSOLCQCVUZDCN-UFTLRZAHSA-N |
| SMILES | CC1=C(C(=O)C2=C(N1)C=CC(=C2)OC)C/C=C(\C)/CC/C=C(\C)/CCC=C(C)C |
Computed by PubChem (NCBI)
Synonyms:
Mtb-cyt-bd oxidase-IN-2