CAS 146348-14-3 appears in our catalog under these names: (S)-methyl 5-oxo-1-((S)-1-phenylethyl)pyrrolidine-3-carboxylate, 98%, (S)–methyl 5–oxo–1–((S)–1–phenylethyl)pyrrolidine–3–carboxylate. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 100mg, 1g, 250mg.
Methyl (3S)-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidine-3-carboxylate (CAS 146348-14-3) is a chemical compound with the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. IUPAC name: methyl (3S)-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidine-3-carboxylate. InChIKey: BENQIPNJLDAXAT-JQWIXIFHSA-N.
| Molecular formula | C14H17NO3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | methyl (3S)-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidine-3-carboxylate |
| InChIKey | BENQIPNJLDAXAT-JQWIXIFHSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)N2C[C@H](CC2=O)C(=O)OC |
Computed by PubChem (NCBI)