CAS 146351-72-6 appears in our catalog under these names: 2-(((1,1-Dimethylethyl)dimethylsilyl)oxy)acetic Acid Methyl Ester, ((tert-Butyldimethylsilyl)oxy)methyl acetate, 97%, ((tert-Butyldimethylsilyl)oxy)methyl acetate, 95%, 95%, Methyl 2-((tert-butyldimethylsilyl)oxy)acetate, 95%. Offered by: TRC, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 100mg, 250mg, 5g, 25g, 100g, 250g.
Methyl 2-[tert-butyl(dimethyl)silyl]oxyacetate (CAS 146351-72-6) is a chemical compound with the molecular formula C9H20O3Si and a molecular weight of 204.34 g/mol. IUPAC name: methyl 2-[tert-butyl(dimethyl)silyl]oxyacetate. InChIKey: KTNTVTQVEAPQNT-UHFFFAOYSA-N.
| Molecular formula | C9H20O3Si |
|---|---|
| Molecular weight | 204.34 g/mol |
| IUPAC name | methyl 2-[tert-butyl(dimethyl)silyl]oxyacetate |
| InChIKey | KTNTVTQVEAPQNT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC(=O)OC |
Computed by PubChem (NCBI)