CAS 14637-34-4 appears in our catalog under these names: Ammonium tetraphenylborate, 95%, Ammonium tetraphenylborate, Ammonium tetraphenylborate 98%, AMMONIUM TETRAPHENYLBORATE, 99%, Ammonium tetraphenylborate, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 25g, 5g, 100g, 10g.
Azanium tetraphenylboranuide (CAS 14637-34-4) is a chemical compound with the molecular formula C24H24BN and a molecular weight of 337.3 g/mol. IUPAC name: azanium tetraphenylboranuide. InChIKey: ZWFYDLYRTYMBIL-UHFFFAOYSA-O.
| Molecular formula | C24H24BN |
|---|---|
| Molecular weight | 337.3 g/mol |
| IUPAC name | azanium tetraphenylboranuide |
| InChIKey | ZWFYDLYRTYMBIL-UHFFFAOYSA-O |
| SMILES | [B-](C1=CC=CC=C1)(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[NH4+] |
Computed by PubChem (NCBI)