CAS 146395-14-4 appears in our catalog under these names: Thp-peg6, 95%, THP–PEG5–OH, THP-PEG5-OH, Thp-peg6, 98%, 98%, THP-PEG5-OH, 98%. Offered by: Combi-blocks, GLPBio, MedChemExpress, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250 mg, 25 mg, 50 mg, 100 mg, 1 g, 100mg.
2-[2-[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol (CAS 146395-14-4) is a chemical compound with the molecular formula C15H30O7 and a molecular weight of 322.39 g/mol. IUPAC name: 2-[2-[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol. InChIKey: ZEGHHDSVKRWOCB-UHFFFAOYSA-N.
| Molecular formula | C15H30O7 |
|---|---|
| Molecular weight | 322.39 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
| InChIKey | ZEGHHDSVKRWOCB-UHFFFAOYSA-N |
| SMILES | C1CCOC(C1)OCCOCCOCCOCCOCCO |
Computed by PubChem (NCBI)