CAS 1464137-16-3 appears in our catalog under these names: (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(1H-tetrazol-5-yl)butanoic acid, 98%, 98%, (R)-2-(FMOC-AMINO)-4-(1H-TETRAZOL-5-YL)BUTANOIC ACID, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(2H-tetrazol-5-yl)butanoic acid (CAS 1464137-16-3) is a chemical compound with the molecular formula C20H19N5O4 and a molecular weight of 393.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(2H-tetrazol-5-yl)butanoic acid. InChIKey: KCVWFZXYTWJVIX-QGZVFWFLSA-N.
| Molecular formula | C20H19N5O4 |
|---|---|
| Molecular weight | 393.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(2H-tetrazol-5-yl)butanoic acid |
| InChIKey | KCVWFZXYTWJVIX-QGZVFWFLSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CCC4=NNN=N4)C(=O)O |
Computed by PubChem (NCBI)