CAS 14642-34-3 appears in our catalog under these names: Tris(8-quinolinolato)gallium(III), Gallium 8-Hydroxyquinolinate, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 500mg, 50mg.
Tri(quinolin-8-yloxy)gallane (CAS 14642-34-3) is a chemical compound with the molecular formula C27H18GaN3O3 and a molecular weight of 502.2 g/mol. IUPAC name: tri(quinolin-8-yloxy)gallane. InChIKey: KWQNQSDKCINQQP-UHFFFAOYSA-K.
| Molecular formula | C27H18GaN3O3 |
|---|---|
| Molecular weight | 502.2 g/mol |
| IUPAC name | tri(quinolin-8-yloxy)gallane |
| InChIKey | KWQNQSDKCINQQP-UHFFFAOYSA-K |
| SMILES | C1=CC2=C(C(=C1)O[Ga](OC3=CC=CC4=C3N=CC=C4)OC5=CC=CC6=C5N=CC=C6)N=CC=C2 |
Computed by PubChem (NCBI)