Products 1465-20-9

CAS 1465-20-9 is the registry number for Fentanyl carbamate. Offered by: Biosynth. Available pack sizes: 25mg, 1mg, 5mg, 10mg, 50mg.

Structural formula: {0} (CAS {1})

Ethyl N-phenyl-N-[1-(2-phenylethyl)piperidin-4-yl]carbamate (CAS 1465-20-9) is a chemical compound with the molecular formula C22H28N2O2 and a molecular weight of 352.5 g/mol. IUPAC name: ethyl N-phenyl-N-[1-(2-phenylethyl)piperidin-4-yl]carbamate. InChIKey: BPXVEPWHWMDYCP-UHFFFAOYSA-N.

Identity
Molecular formulaC22H28N2O2
Molecular weight352.5 g/mol
IUPAC nameethyl N-phenyl-N-[1-(2-phenylethyl)piperidin-4-yl]carbamate
InChIKeyBPXVEPWHWMDYCP-UHFFFAOYSA-N
SMILESCCOC(=O)N(C1CCN(CC1)CCC2=CC=CC=C2)C3=CC=CC=C3

Computed by PubChem (NCBI)