Products 146502-77-4
CAS 146502-77-4 is the registry number for Rel-(1R,3S)-1,2,2-trimethylcyclopentane-1,3-diamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1R,3S)-1,2,2-trimethylcyclopentane-1,3-diamine (CAS 146502-77-4) is a chemical compound with the molecular formula C8H18N2 and a molecular weight of 142.24 g/mol. IUPAC name: trans-(1R,3S)-1,2,2-trimethylcyclopentane-1,3-diamine. InChIKey: XBFJECMZLDVTML-POYBYMJQSA-N.
| Molecular formula | C8H18N2 |
|---|---|
| Molecular weight | 142.24 g/mol |
| IUPAC name | trans-(1R,3S)-1,2,2-trimethylcyclopentane-1,3-diamine |
| InChIKey | XBFJECMZLDVTML-POYBYMJQSA-N |
| SMILES | C[C@]1(CC[C@@H](C1(C)C)N)N |
Computed by PubChem (NCBI)