CAS 14651-91-3 appears in our catalog under these names: 5,10,15,20-Tetra(4-pyridyl)porphyrin iron, 95%, 95%, 5,10,15,20-Tetra (4-pyridyl) porphyrin iron, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Iron(2+);5,10,15,20-tetrapyridin-4-ylporphyrin-22,24-diide (CAS 14651-91-3) is a chemical compound with the molecular formula C40H24FeN8 and a molecular weight of 672.5 g/mol. IUPAC name: iron(2+);5,10,15,20-tetrapyridin-4-ylporphyrin-22,24-diide. InChIKey: DUVWLFDRXHMGJM-UHFFFAOYSA-N.
| Molecular formula | C40H24FeN8 |
|---|---|
| Molecular weight | 672.5 g/mol |
| IUPAC name | iron(2+);5,10,15,20-tetrapyridin-4-ylporphyrin-22,24-diide |
| InChIKey | DUVWLFDRXHMGJM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=NC(=C(C4=CC=C([N-]4)C(=C5C=CC(=N5)C(=C1[N-]2)C6=CC=NC=C6)C7=CC=NC=C7)C8=CC=NC=C8)C=C3)C9=CC=NC=C9.[Fe+2] |
Computed by PubChem (NCBI)