CAS 146548-14-3 is the registry number for tert-Butyl rac-(4ar,8ar)-6-oxooctahydro-2(1h)-isoquinolinecarboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 250mg, 1g.
Tert-butyl (4aR,8aR)-6-oxo-1,3,4,4a,5,7,8,8a-octahydroisoquinoline-2-carboxylate (CAS 146548-14-3) is a chemical compound with the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. IUPAC name: tert-butyl (4aR,8aR)-6-oxo-1,3,4,4a,5,7,8,8a-octahydroisoquinoline-2-carboxylate. InChIKey: MNWQGQXNDLLERG-MNOVXSKESA-N.
| Molecular formula | C14H23NO3 |
|---|---|
| Molecular weight | 253.34 g/mol |
| IUPAC name | tert-butyl (4aR,8aR)-6-oxo-1,3,4,4a,5,7,8,8a-octahydroisoquinoline-2-carboxylate |
| InChIKey | MNWQGQXNDLLERG-MNOVXSKESA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]2CC(=O)CC[C@H]2C1 |
Computed by PubChem (NCBI)