Products 1465601-43-7

CAS 1465601-43-7 is the registry number for tert-Butyl N-methyl-N-{2-(2-(methylamino)ethoxy)ethyl}carbamate. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-methyl-N-[2-[2-(methylamino)ethoxy]ethyl]carbamate (CAS 1465601-43-7) is a chemical compound with the molecular formula C11H24N2O3 and a molecular weight of 232.32 g/mol. IUPAC name: tert-butyl N-methyl-N-[2-[2-(methylamino)ethoxy]ethyl]carbamate. InChIKey: YOEVQNJUENFAER-UHFFFAOYSA-N.

Identity
Molecular formulaC11H24N2O3
Molecular weight232.32 g/mol
IUPAC nametert-butyl N-methyl-N-[2-[2-(methylamino)ethoxy]ethyl]carbamate
InChIKeyYOEVQNJUENFAER-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N(C)CCOCCNC

Computed by PubChem (NCBI)