CAS 146616-66-2 appears in our catalog under these names: BDP FL NHS ester, 95%, Bdp fl nhs ester, 98%, BDY FL, SE, BDY FL, SE, BODIPY-FL NHS ester. Offered by: Lumiprobe, Combi-blocks, TRC, GLPBio, TargetMol. Available pack sizes: 1mg, 5mg, 25mg, 50mg, 100mg, 10mg, -, 1g.
(2,5-dioxopyrrolidin-1-yl) 3-(2,2-difluoro-10,12-dimethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-4-yl)propanoate (CAS 146616-66-2) is a chemical compound with the molecular formula C18H18BF2N3O4 and a molecular weight of 389.2 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-(2,2-difluoro-10,12-dimethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-4-yl)propanoate. InChIKey: SDVMGNSTOAJONW-UHFFFAOYSA-N.
| Molecular formula | C18H18BF2N3O4 |
|---|---|
| Molecular weight | 389.2 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-(2,2-difluoro-10,12-dimethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-4-yl)propanoate |
| InChIKey | SDVMGNSTOAJONW-UHFFFAOYSA-N |
| SMILES | [B-]1(N2C(=CC(=C2C=C3[N+]1=C(C=C3)CCC(=O)ON4C(=O)CCC4=O)C)C)(F)F |
Computed by PubChem (NCBI)