CAS 146617-38-1 appears in our catalog under these names: 1,1-Dimethyl-2,3-dihydrobenzo[d][1,3]azasilin-4(1H)-one, 98%, 98%, 1,1-Dimethyl-2,3-dihydrobenzo[d][1,3]azasilin-4(1H)-one, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1,1-dimethyl-2,3-dihydro-3,1-benzazasilin-4-one (CAS 146617-38-1) is a chemical compound with the molecular formula C10H13NOSi and a molecular weight of 191.30 g/mol. IUPAC name: 1,1-dimethyl-2,3-dihydro-3,1-benzazasilin-4-one. InChIKey: VCEKLOSJVFDIGK-UHFFFAOYSA-N.
| Molecular formula | C10H13NOSi |
|---|---|
| Molecular weight | 191.30 g/mol |
| IUPAC name | 1,1-dimethyl-2,3-dihydro-3,1-benzazasilin-4-one |
| InChIKey | VCEKLOSJVFDIGK-UHFFFAOYSA-N |
| SMILES | C[Si]1(CNC(=O)C2=CC=CC=C21)C |
Computed by PubChem (NCBI)