CAS 146628-55-9 appears in our catalog under these names: 2-(Trifluoromethyl)-1,3-dioxaindan-2-amine, 95%, 2-(Trifluoromethyl)-1,3-dioxaindan-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-(trifluoromethyl)-1,3-benzodioxol-2-amine (CAS 146628-55-9) is a chemical compound with the molecular formula C8H6F3NO2 and a molecular weight of 205.13 g/mol. IUPAC name: 2-(trifluoromethyl)-1,3-benzodioxol-2-amine. InChIKey: DBWUPJGZOLJPLU-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO2 |
|---|---|
| Molecular weight | 205.13 g/mol |
| IUPAC name | 2-(trifluoromethyl)-1,3-benzodioxol-2-amine |
| InChIKey | DBWUPJGZOLJPLU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)OC(O2)(C(F)(F)F)N |
Computed by PubChem (NCBI)