Products 1466552-36-2
CAS 1466552-36-2 appears in our catalog under these names: Nonanal-d18, >95% (GC), Nonanal-d18, 98 atom % D, min 96% Chemical Purity, Nonanal-d18, Nonanal-d18, 98.31%, D18-Nonanal. Offered by: TRC, CDN, Biosynth, MedChemExpress, HPC Standards. Available pack sizes: 10mg, 25mg, 0,25g, 0,1g, 100mg, 1 mg, 1x10mg.
1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-octadecadeuteriononan-1-one (CAS 1466552-36-2) is a chemical compound with the molecular formula C9H18O and a molecular weight of 160.35 g/mol. IUPAC name: 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-octadecadeuteriononan-1-one. InChIKey: GYHFUZHODSMOHU-PBYHGZINSA-N.
| Molecular formula | C9H18O |
|---|---|
| Molecular weight | 160.35 g/mol |
| IUPAC name | 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-octadecadeuteriononan-1-one |
| InChIKey | GYHFUZHODSMOHU-PBYHGZINSA-N |
| SMILES | [2H]C(=O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)