Products 1466898-07-6
CAS 1466898-07-6 is the registry number for 1-(4-Bromo-2-(trifluoromethyl)phenyl)-2,2-dimethylpropan-1-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-[4-bromo-2-(trifluoromethyl)phenyl]-2,2-dimethylpropan-1-one (CAS 1466898-07-6) is a chemical compound with the molecular formula C12H12BrF3O and a molecular weight of 309.12 g/mol. IUPAC name: 1-[4-bromo-2-(trifluoromethyl)phenyl]-2,2-dimethylpropan-1-one. InChIKey: ADMIYKQBPLGFLC-UHFFFAOYSA-N.
| Molecular formula | C12H12BrF3O |
|---|---|
| Molecular weight | 309.12 g/mol |
| IUPAC name | 1-[4-bromo-2-(trifluoromethyl)phenyl]-2,2-dimethylpropan-1-one |
| InChIKey | ADMIYKQBPLGFLC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C1=C(C=C(C=C1)Br)C(F)(F)F |
Computed by PubChem (NCBI)