CAS 1467060-29-2 is the registry number for tert-Butyl 3-(4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl)pyrrolidine-1-carboxylate, 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
Tert-butyl 3-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]pyrrolidine-1-carboxylate (CAS 1467060-29-2) is a chemical compound with the molecular formula C20H30BNO4 and a molecular weight of 359.3 g/mol. IUPAC name: tert-butyl 3-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]pyrrolidine-1-carboxylate. InChIKey: HABUFMBLZJDUQT-UHFFFAOYSA-N.
| Molecular formula | C20H30BNO4 |
|---|---|
| Molecular weight | 359.3 g/mol |
| IUPAC name | tert-butyl 3-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]pyrrolidine-1-carboxylate |
| InChIKey | HABUFMBLZJDUQT-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=C(C=C2)C3CCN(C3)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)