Products 1467663-02-0

CAS 1467663-02-0 is the registry number for Thieno[3,2-b]thiophene-3-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Thieno[3,2-b]thiophene-6-carboxylic acid (CAS 1467663-02-0) is a chemical compound with the molecular formula C7H4O2S2 and a molecular weight of 184.2 g/mol. IUPAC name: thieno[3,2-b]thiophene-6-carboxylic acid. InChIKey: UXNPVBDEXUQKHA-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4O2S2
Molecular weight184.2 g/mol
IUPAC namethieno[3,2-b]thiophene-6-carboxylic acid
InChIKeyUXNPVBDEXUQKHA-UHFFFAOYSA-N
SMILESC1=CSC2=C1SC=C2C(=O)O

Computed by PubChem (NCBI)