CAS 1467777-26-9 is the registry number for (S)-2-Amino-6-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)hexanoic acid hydrochloride, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2S)-2-amino-6-(2,5-dioxopyrrol-1-yl)hexanoic acid;hydrochloride (CAS 1467777-26-9) is a chemical compound with the molecular formula C10H15ClN2O4 and a molecular weight of 262.69 g/mol. IUPAC name: (2S)-2-amino-6-(2,5-dioxopyrrol-1-yl)hexanoic acid;hydrochloride. InChIKey: LUJLLWRTQYTNKG-FJXQXJEOSA-N.
| Molecular formula | C10H15ClN2O4 |
|---|---|
| Molecular weight | 262.69 g/mol |
| IUPAC name | (2S)-2-amino-6-(2,5-dioxopyrrol-1-yl)hexanoic acid;hydrochloride |
| InChIKey | LUJLLWRTQYTNKG-FJXQXJEOSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCCC[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)