CAS 14679-27-7 is the registry number for cis-1-Methyl-1,2-cyclohexanedicarboxylic Anhydride. Offered by: TRC. Available pack sizes: 100mg, 1g, 500mg.
(3aS,7aR)-7a-methyl-4,5,6,7-tetrahydro-3aH-2-benzofuran-1,3-dione (CAS 14679-27-7) is a chemical compound with the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. IUPAC name: (3aS,7aR)-7a-methyl-4,5,6,7-tetrahydro-3aH-2-benzofuran-1,3-dione. InChIKey: VYKXQOYUCMREIS-HZGVNTEJSA-N.
| Molecular formula | C9H12O3 |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | (3aS,7aR)-7a-methyl-4,5,6,7-tetrahydro-3aH-2-benzofuran-1,3-dione |
| InChIKey | VYKXQOYUCMREIS-HZGVNTEJSA-N |
| SMILES | C[C@@]12CCCC[C@@H]1C(=O)OC2=O |
Computed by PubChem (NCBI)