CAS 146829-79-0 appears in our catalog under these names: Bis[2-(fluorosulfonyl)tetrafluoroethyl]ether, 95%, Bis[2-(fluorosulphonyl)tetrafluoroethyl]ether, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-fluorosulfonylethoxy)ethanesulfonyl fluoride (CAS 146829-79-0) is a chemical compound with the molecular formula C4F10O5S2 and a molecular weight of 382.2 g/mol. IUPAC name: 1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-fluorosulfonylethoxy)ethanesulfonyl fluoride. InChIKey: LKJIAQKFEYWIKU-UHFFFAOYSA-N.
| Molecular formula | C4F10O5S2 |
|---|---|
| Molecular weight | 382.2 g/mol |
| IUPAC name | 1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-fluorosulfonylethoxy)ethanesulfonyl fluoride |
| InChIKey | LKJIAQKFEYWIKU-UHFFFAOYSA-N |
| SMILES | C(C(F)(F)S(=O)(=O)F)(OC(C(F)(F)S(=O)(=O)F)(F)F)(F)F |
Computed by PubChem (NCBI)