CAS 146838-41-7 appears in our catalog under these names: Sodium (S)-3,4-dihydroxybutanoate, 98%, Sodium (S)-3,4-Dihydroxybutanoate, >95%, >95%, (S)-3,4-Dihydroxybutyric acid (sodium). Offered by: AmBeed, Chemat, MedChemExpress. Available pack sizes: 10g, 1g, 50 mg, 25 mg, 100 mg.
Sodium (3S)-3,4-dihydroxybutanoate (CAS 146838-41-7) is a chemical compound with the molecular formula C4H7NaO4 and a molecular weight of 142.09 g/mol. IUPAC name: sodium (3S)-3,4-dihydroxybutanoate. InChIKey: NOWFAQVJTIYOTK-DFWYDOINSA-M.
| Molecular formula | C4H7NaO4 |
|---|---|
| Molecular weight | 142.09 g/mol |
| IUPAC name | sodium (3S)-3,4-dihydroxybutanoate |
| InChIKey | NOWFAQVJTIYOTK-DFWYDOINSA-M |
| SMILES | C([C@@H](CO)O)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)