CAS 146845-34-3 appears in our catalog under these names: Cilnidipine Impurity A, (E)-Dehydro Cilnidipine, (E)-Dehydro Cilnidipine, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg, 5mg.
5-O-(2-methoxyethyl) 3-O-[(E)-3-phenylprop-2-enyl] 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate (CAS 146845-34-3) is a chemical compound with the molecular formula C27H26N2O7 and a molecular weight of 490.5 g/mol. IUPAC name: 5-O-(2-methoxyethyl) 3-O-[(E)-3-phenylprop-2-enyl] 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate. InChIKey: HUTPFIMQINDZDT-DHZHZOJOSA-N.
| Molecular formula | C27H26N2O7 |
|---|---|
| Molecular weight | 490.5 g/mol |
| IUPAC name | 5-O-(2-methoxyethyl) 3-O-[(E)-3-phenylprop-2-enyl] 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate |
| InChIKey | HUTPFIMQINDZDT-DHZHZOJOSA-N |
| SMILES | CC1=C(C(=C(C(=N1)C)C(=O)OC/C=C/C2=CC=CC=C2)C3=CC(=CC=C3)[N+](=O)[O-])C(=O)OCCOC |
Computed by PubChem (NCBI)