CAS 146864-62-2 appears in our catalog under these names: N-(1-Naphthalenesulfonyl)-l-phenylalanyl chloride, 95%, (S)-2-(Naphthalene-1-sulfonamido)-3-phenylpropanoyl chloride, 97%, N–(1–Naphthalenesulfonyl)–L–phenylalanyl Chloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 10g, 5g, 1g.
(2S)-2-(naphthalen-1-ylsulfonylamino)-3-phenylpropanoyl chloride (CAS 146864-62-2) is a chemical compound with the molecular formula C19H16ClNO3S and a molecular weight of 373.9 g/mol. IUPAC name: (2S)-2-(naphthalen-1-ylsulfonylamino)-3-phenylpropanoyl chloride. InChIKey: CDECDNASIKPCAM-KRWDZBQOSA-N.
| Molecular formula | C19H16ClNO3S |
|---|---|
| Molecular weight | 373.9 g/mol |
| IUPAC name | (2S)-2-(naphthalen-1-ylsulfonylamino)-3-phenylpropanoyl chloride |
| InChIKey | CDECDNASIKPCAM-KRWDZBQOSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)Cl)NS(=O)(=O)C2=CC=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)