CAS 14689-45-3 appears in our catalog under these names: Cadmium acetylacetonate, CADMIUM ACETYLACETONATE, >=99.9% METALS&. Offered by: GLPBio, Sigma-Aldrich. Available pack sizes: 100g, 25g, 50G.
Cadmium(2+);bis((Z)-4-oxopent-2-en-2-olate) (CAS 14689-45-3) is a chemical compound with the molecular formula C10H14CdO4 and a molecular weight of 310.63 g/mol. IUPAC name: cadmium(2+);bis((Z)-4-oxopent-2-en-2-olate). InChIKey: JXULEGTWCQDLTM-FDGPNNRMSA-L.
| Molecular formula | C10H14CdO4 |
|---|---|
| Molecular weight | 310.63 g/mol |
| IUPAC name | cadmium(2+);bis((Z)-4-oxopent-2-en-2-olate) |
| InChIKey | JXULEGTWCQDLTM-FDGPNNRMSA-L |
| SMILES | C/C(=C/C(=O)C)/[O-].C/C(=C/C(=O)C)/[O-].[Cd+2] |
Computed by PubChem (NCBI)