CAS 1469337-95-8 appears in our catalog under these names: K-Ras(G12C) Inhibitor 12, K-Ras(G12C) inhibitor 12, 99%, K–Ras(G12C) inhibitor 12, K-Ras(G12C) inhibitor 12/ 99.44% (existing batch purity), K-Ras(G12C) inhibitor 12 98%. Offered by: Chemat Brand, AmBeed, GLPBio, TargetMol, Biosynth. Available pack sizes: on request, 5mg, 25mg, 10mM (in 1ml dmso), 1mg, 10mg, 50mg, 100mg.
1-[4-[2-(4-chloro-2-hydroxy-5-iodoanilino)acetyl]piperazin-1-yl]prop-2-en-1-one (CAS 1469337-95-8) is a chemical compound with the molecular formula C15H17ClIN3O3 and a molecular weight of 449.67 g/mol. IUPAC name: 1-[4-[2-(4-chloro-2-hydroxy-5-iodoanilino)acetyl]piperazin-1-yl]prop-2-en-1-one. InChIKey: JFIFBWVNHLXJFY-UHFFFAOYSA-N.
| Molecular formula | C15H17ClIN3O3 |
|---|---|
| Molecular weight | 449.67 g/mol |
| IUPAC name | 1-[4-[2-(4-chloro-2-hydroxy-5-iodoanilino)acetyl]piperazin-1-yl]prop-2-en-1-one |
| InChIKey | JFIFBWVNHLXJFY-UHFFFAOYSA-N |
| SMILES | C=CC(=O)N1CCN(CC1)C(=O)CNC2=CC(=C(C=C2O)Cl)I |
Computed by PubChem (NCBI)