CAS 146939-64-2 is the registry number for FR-146687. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[1-[4-[(1S)-1-[4-(2-methylpropyl)phenyl]butoxy]benzoyl]indolizin-3-yl]butanoic acid (CAS 146939-64-2) is a chemical compound with the molecular formula C33H37NO4 and a molecular weight of 511.6 g/mol. IUPAC name: 4-[1-[4-[(1S)-1-[4-(2-methylpropyl)phenyl]butoxy]benzoyl]indolizin-3-yl]butanoic acid. InChIKey: MVPWJFWMEIXDQW-HKBQPEDESA-N.
| Molecular formula | C33H37NO4 |
|---|---|
| Molecular weight | 511.6 g/mol |
| IUPAC name | 4-[1-[4-[(1S)-1-[4-(2-methylpropyl)phenyl]butoxy]benzoyl]indolizin-3-yl]butanoic acid |
| InChIKey | MVPWJFWMEIXDQW-HKBQPEDESA-N |
| SMILES | CCC[C@@H](C1=CC=C(C=C1)CC(C)C)OC2=CC=C(C=C2)C(=O)C3=C4C=CC=CN4C(=C3)CCCC(=O)O |
Computed by PubChem (NCBI)