CAS 14697-50-8 is the registry number for 2,2′-Oxybis(4,4,6-trimethyl-1,3,2-dioxaborinane). Offered by: TRC. Available pack sizes: 100mg, 10mg.
4,4,6-trimethyl-2-[(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)oxy]-1,3,2-dioxaborinane (CAS 14697-50-8) is a chemical compound with the molecular formula C12H24B2O5 and a molecular weight of 269.9 g/mol. IUPAC name: 4,4,6-trimethyl-2-[(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)oxy]-1,3,2-dioxaborinane. InChIKey: KUZYYSNLEIAJQJ-UHFFFAOYSA-N.
| Molecular formula | C12H24B2O5 |
|---|---|
| Molecular weight | 269.9 g/mol |
| IUPAC name | 4,4,6-trimethyl-2-[(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)oxy]-1,3,2-dioxaborinane |
| InChIKey | KUZYYSNLEIAJQJ-UHFFFAOYSA-N |
| SMILES | B1(OC(CC(O1)(C)C)C)OB2OC(CC(O2)(C)C)C |
Computed by PubChem (NCBI)