Products 1469758-99-3
CAS 1469758-99-3 is the registry number for Triethanolamine-d12. Offered by: TRC. Available pack sizes: 100mg, 10mg.
2-[bis(1,1,2,2-tetradeuterio-2-hydroxyethyl)amino]-1,1,2,2-tetradeuterioethanol (CAS 1469758-99-3) is a chemical compound with the molecular formula C6H15NO3 and a molecular weight of 161.26 g/mol. IUPAC name: 2-[bis(1,1,2,2-tetradeuterio-2-hydroxyethyl)amino]-1,1,2,2-tetradeuterioethanol. InChIKey: GSEJCLTVZPLZKY-LBTWDOQPSA-N.
| Molecular formula | C6H15NO3 |
|---|---|
| Molecular weight | 161.26 g/mol |
| IUPAC name | 2-[bis(1,1,2,2-tetradeuterio-2-hydroxyethyl)amino]-1,1,2,2-tetradeuterioethanol |
| InChIKey | GSEJCLTVZPLZKY-LBTWDOQPSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])O)N(C([2H])([2H])C([2H])([2H])O)C([2H])([2H])C([2H])([2H])O |
Computed by PubChem (NCBI)