CAS 146976-19-4 appears in our catalog under these names: 2-(Bromomethyl)-5-phenylpyrimidine, 97%, 2-(Bromomethyl)-5-phenylpyrimidine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-(bromomethyl)-5-phenylpyrimidine (CAS 146976-19-4) is a chemical compound with the molecular formula C11H9BrN2 and a molecular weight of 249.11 g/mol. IUPAC name: 2-(bromomethyl)-5-phenylpyrimidine. InChIKey: URRLCUSVKQBENI-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2 |
|---|---|
| Molecular weight | 249.11 g/mol |
| IUPAC name | 2-(bromomethyl)-5-phenylpyrimidine |
| InChIKey | URRLCUSVKQBENI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(N=C2)CBr |
Computed by PubChem (NCBI)